| Name |
4-(1H-pyrazol-1-yl)-N-{[7-(trifluoromethyl)-5H,6H,7H,8H-[1,2,4]triazolo[4,3-a]pyridin-3-yl]methyl}benzene-1-sulfonamide
|
| Molecular Formula |
C17H17F3N6O2S
|
| Molecular Weight |
426.4
|
| Smiles |
O=S(=O)(NCc1nnc2n1CCC(C(F)(F)F)C2)c1ccc(-n2cccn2)cc1
|
O=S(=O)(NCc1nnc2n1CCC(C(F)(F)F)C2)c1ccc(-n2cccn2)cc1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.