| Name |
4-{[Methyl(1-{[1,2,4]triazolo[4,3-b]pyridazin-6-yl}azetidin-3-yl)amino]methyl}benzonitrile
|
| Molecular Formula |
C17H17N7
|
| Molecular Weight |
319.4
|
| Smiles |
CN(Cc1ccc(C#N)cc1)C1CN(c2ccc3nncn3n2)C1
|
CN(Cc1ccc(C#N)cc1)C1CN(c2ccc3nncn3n2)C1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.