| Name |
(2,4-Diamino-5,6,7,8-tetrahydropteridin-6-yl)methanol; trifluoroacetic acid
|
| Molecular Formula |
C9H13F3N6O3
|
| Molecular Weight |
310.23
|
| Smiles |
Nc1nc(N)c2c(n1)NCC(CO)N2.O=C(O)C(F)(F)F
|
Nc1nc(N)c2c(n1)NCC(CO)N2.O=C(O)C(F)(F)F
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.