| Name |
10-[3'-(hydroxymethyl)-5-({5-[(2S)-2-methyl-4-(oxetan-3-yl)piperazin-1-yl]pyridin-2-yl}amino)-6-oxo-1,6-dihydro-[3,4'-bipyridine]-2'-yl]-4,4-dimethyl-1,10-diazatricyclo[6.4.0.0(2),]dodeca-2(6),7-dien-9-one
|
| Molecular Formula |
C36H42N8O4
|
| Molecular Weight |
650.8
|
| Smiles |
CC1CN(C2COC2)CCN1c1ccc(Nc2cc(-c3ccnc(N4CCn5c(cc6c5CC(C)(C)C6)C4=O)c3CO)c[nH]c2=O)nc1
|
CC1CN(C2COC2)CCN1c1ccc(Nc2cc(-c3ccnc(N4CCn5c(cc6c5CC(C)(C)C6)C4=O)c3CO)c[nH]c2=O)nc1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.