| Name |
N-((4,6-bis(dimethylamino)-1,3,5-triazin-2-yl)methyl)-5-chlorothiophene-2-sulfonamide
|
| Molecular Formula |
C12H17ClN6O2S2
|
| Molecular Weight |
376.9
|
| Smiles |
CN(C)c1nc(CNS(=O)(=O)c2ccc(Cl)s2)nc(N(C)C)n1
|
CN(C)c1nc(CNS(=O)(=O)c2ccc(Cl)s2)nc(N(C)C)n1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.