| Name |
[7-(Trifluoromethyl)-[1,2,4]triazolo[4,3-a]pyridin-3-yl]methanamine dihydrochloride
|
| Molecular Formula |
C8H9Cl2F3N4
|
| Molecular Weight |
289.08
|
| Smiles |
Cl.Cl.NCc1nnc2cc(C(F)(F)F)ccn12
|
Cl.Cl.NCc1nnc2cc(C(F)(F)F)ccn12
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.