| Name |
6-Cyclopropyl-2-[(1-{thieno[3,2-d]pyrimidin-4-yl}piperidin-4-yl)methyl]-2,3-dihydropyridazin-3-one
|
| Molecular Formula |
C19H21N5OS
|
| Molecular Weight |
367.5
|
| Smiles |
O=c1ccc(C2CC2)nn1CC1CCN(c2ncnc3ccsc23)CC1
|
O=c1ccc(C2CC2)nn1CC1CCN(c2ncnc3ccsc23)CC1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.