| Name |
[6-(4,6-Diphenyl-1,3,5-triazin-2-yl)dibenzofuran-4-yl]boronic acid
|
| Molecular Formula |
C27H18BN3O3
|
| Molecular Weight |
443.3
|
| Smiles |
OB(O)c1cccc2c1oc1c(-c3nc(-c4ccccc4)nc(-c4ccccc4)n3)cccc12
|
OB(O)c1cccc2c1oc1c(-c3nc(-c4ccccc4)nc(-c4ccccc4)n3)cccc12
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.