| Name |
2H-Pyrrol-2-one, 1-(3-bromophenyl)-5-(3-ethoxyphenyl)-4-(4-fluorophenyl)-1,5-dihydro-3-hydroxy-
|
| Molecular Formula |
C24H19BrFNO3
|
| Molecular Weight |
468.3
|
| Smiles |
CCOc1cccc(C2C(c3ccc(F)cc3)=C(O)C(=O)N2c2cccc(Br)c2)c1
|
CCOc1cccc(C2C(c3ccc(F)cc3)=C(O)C(=O)N2c2cccc(Br)c2)c1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.