| Name |
1-(3-Bromophenyl)-6,6-dimethyl-1,4,5,6-tetrahydrocyclopenta[C]pyrazole
|
| Molecular Formula |
C14H15BrN2
|
| Molecular Weight |
291.19
|
| Smiles |
CC1(C)CCc2cnn(-c3cccc(Br)c3)c21
|
CC1(C)CCc2cnn(-c3cccc(Br)c3)c21
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.