| Name |
tert-Butyl (tetrahydro-2H-pyran-4-yl)((6,7,8,9-tetrahydro-5H-imidazo[1,5-a][1,4]diazepin-1-yl)methyl)carbamate
|
| Molecular Formula |
C18H30N4O3
|
| Molecular Weight |
350.5
|
| Smiles |
CC(C)(C)OC(=O)N(Cc1ncn2c1CNCCC2)C1CCOCC1
|
CC(C)(C)OC(=O)N(Cc1ncn2c1CNCCC2)C1CCOCC1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.