| Name |
5-Pyrimidinecarbonyl azide, 2-amino-
|
| Molecular Formula |
C5H4N6O
|
| Molecular Weight |
164.13
|
| Smiles |
[N-]=[N+]=NC(=O)c1cnc(N)nc1
|
[N-]=[N+]=NC(=O)c1cnc(N)nc1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.