| Name |
2-(6-Nitro-2,4-dioxo-3,4-dihydro-2H-1,3-benzoxazin-3-yl)acetic acid
|
| Molecular Formula |
C10H6N2O7
|
| Molecular Weight |
266.16
|
| Smiles |
O=C(O)Cn1c(=O)oc2ccc([N+](=O)[O-])cc2c1=O
|
O=C(O)Cn1c(=O)oc2ccc([N+](=O)[O-])cc2c1=O
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.