| Name |
6,7-Dimethoxy-1'-propyl-1H-spiro[isoquinoline-3,4'-piperidin]-4(2H)-one
|
| Molecular Formula |
C18H26N2O3
|
| Molecular Weight |
318.4
|
| Smiles |
CCCN1CCC2(CC1)NCc1cc(OC)c(OC)cc1C2=O
|
CCCN1CCC2(CC1)NCc1cc(OC)c(OC)cc1C2=O
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.