| Name |
2,2-Dimethyl-6-phenyl-[1,3]dioxolo[4,5-f][1,10]phenanthroline
|
| Molecular Formula |
C21H16N2O2
|
| Molecular Weight |
328.4
|
| Smiles |
CC1(C)Oc2c(c3ccc(-c4ccccc4)nc3c3ncccc23)O1
|
CC1(C)Oc2c(c3ccc(-c4ccccc4)nc3c3ncccc23)O1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.