| Name |
3-(1-(3',4'-Dichloro-[1,1'-biphenyl]-4-carbonyl)azetidin-3-yl)imidazolidine-2,4-dione
|
| Molecular Formula |
C19H15Cl2N3O3
|
| Molecular Weight |
404.2
|
| Smiles |
O=C(c1ccc(-c2ccc(Cl)c(Cl)c2)cc1)N1CC(N2C(=O)CNC2=O)C1
|
O=C(c1ccc(-c2ccc(Cl)c(Cl)c2)cc1)N1CC(N2C(=O)CNC2=O)C1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.