| Name |
3-(1-((3-Methyl-2-oxo-2,3-dihydrobenzo[d]oxazol-5-yl)sulfonyl)azetidin-3-yl)imidazolidine-2,4-dione
|
| Molecular Formula |
C14H14N4O6S
|
| Molecular Weight |
366.35
|
| Smiles |
Cn1c(=O)oc2ccc(S(=O)(=O)N3CC(N4C(=O)CNC4=O)C3)cc21
|
Cn1c(=O)oc2ccc(S(=O)(=O)N3CC(N4C(=O)CNC4=O)C3)cc21
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.