| Name |
Benzenesulfonamide, 4-hydroxy-2,6-diiodo-
|
| Molecular Formula |
C6H5I2NO3S
|
| Molecular Weight |
424.98
|
| Smiles |
NS(=O)(=O)c1c(I)cc(O)cc1I
|
NS(=O)(=O)c1c(I)cc(O)cc1I
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.