| Name |
1,7-Diazaspiro[3.5]nonane,bis(trifluoroaceticacid)
|
| Molecular Formula |
C11H16F6N2O4
|
| Molecular Weight |
354.25
|
| Smiles |
C1CC2(CCN1)CCN2.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F
|
C1CC2(CCN1)CCN2.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.