| Name |
O9-benzyl O7-tert-butyl 6-oxo-3-oxa-7,9-diazabicyclo[3.3.1]nonane-7,9-dicarboxylate
|
| Molecular Formula |
C19H24N2O6
|
| Molecular Weight |
376.4
|
| Smiles |
CC(C)(C)OC(=O)N1CC2COCC(C1=O)N2C(=O)OCc1ccccc1
|
CC(C)(C)OC(=O)N1CC2COCC(C1=O)N2C(=O)OCc1ccccc1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.