| Name |
5,6-Dibromo-1H-indene-1,3(2H)-dione
|
| Molecular Formula |
C9H4Br2O2
|
| Molecular Weight |
303.93
|
| Smiles |
O=C1CC(=O)c2cc(Br)c(Br)cc21
|
O=C1CC(=O)c2cc(Br)c(Br)cc21
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.