| Name |
3-Acetonyl-2-hydroxy-5,8-dimethoxy-1,4-naphthoquinone
|
| Molecular Formula |
C15H14O6
|
| Molecular Weight |
290.27
|
| Smiles |
COc1ccc(OC)c2c1C(=O)C(=O)C(CC(C)=O)=C2O
|
COc1ccc(OC)c2c1C(=O)C(=O)C(CC(C)=O)=C2O
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.