| Name |
9-(tert-Butyl) 3-ethyl (1S,5R)-2-oxo-9-azabicyclo[3.3.1]nonane-3,9-dicarboxylate
|
| Molecular Formula |
C16H25NO5
|
| Molecular Weight |
311.37
|
| Smiles |
CCOC(=O)C1CC2CCCC(C1=O)N2C(=O)OC(C)(C)C
|
CCOC(=O)C1CC2CCCC(C1=O)N2C(=O)OC(C)(C)C
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.