| Name |
N-{4-[8-chloro-6-(trifluoromethyl)imidazo[1,2-a]pyridin-2-yl]phenyl}-4-methylbenzamide
|
| Molecular Formula |
C22H15ClF3N3O
|
| Molecular Weight |
429.8
|
| Smiles |
Cc1ccc(C(=O)Nc2ccc(-c3cn4cc(C(F)(F)F)cc(Cl)c4n3)cc2)cc1
|
Cc1ccc(C(=O)Nc2ccc(-c3cn4cc(C(F)(F)F)cc(Cl)c4n3)cc2)cc1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.