| Name |
2-Chloro-1-[2,3-dihydro-6-(1-hydroxybutyl)-3,3-dimethyl-1H-pyrrolo[3,2-c]pyridin-1-yl]ethanone hydrochloride
|
| Molecular Formula |
C15H22Cl2N2O2
|
| Molecular Weight |
333.2
|
| Smiles |
CCCC(O)c1cc2c(cn1)C(C)(C)CN2C(=O)CCl.Cl
|
CCCC(O)c1cc2c(cn1)C(C)(C)CN2C(=O)CCl.Cl
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.