| Name |
2-Chloro-4-nitro-4'-(trifluoromethoxy)-1,1'-biphenyl
|
| Molecular Formula |
C13H7ClF3NO3
|
| Molecular Weight |
317.65
|
| Smiles |
O=[N+]([O-])c1ccc(-c2ccc(OC(F)(F)F)cc2)c(Cl)c1
|
O=[N+]([O-])c1ccc(-c2ccc(OC(F)(F)F)cc2)c(Cl)c1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.