| Name |
(2S)-2-{[1-(2-fluorophenyl)ethyl]amino}-3-methylbutan-1-ol hydrochloride
|
| Molecular Formula |
C13H21ClFNO
|
| Molecular Weight |
261.76
|
| Smiles |
CC(NC(CO)C(C)C)c1ccccc1F.Cl
|
CC(NC(CO)C(C)C)c1ccccc1F.Cl
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.