| Name |
1,3,4,6-Tetramethyl-3,6-epithio-2,5-dioxopiperazine
|
| Molecular Formula |
C8H12N2O2S
|
| Molecular Weight |
200.26
|
| Smiles |
CN1C(=O)C2(C)SC1(C)C(=O)N2C
|
CN1C(=O)C2(C)SC1(C)C(=O)N2C
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.