| Name |
5,8-Methanocinnoline, 3-(2,6-difluorophenyl)-5,6,7,8-tetrahydro-8,9,9-trimethyl-, (5R,8S)-
|
| Molecular Formula |
C18H18F2N2
|
| Molecular Weight |
300.3
|
| Smiles |
CC12CCC(c3cc(-c4c(F)cccc4F)nnc31)C2(C)C
|
CC12CCC(c3cc(-c4c(F)cccc4F)nnc31)C2(C)C
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.