| Name |
Propanoic acid, 3-[(5-bromo-2-fluorophenyl)methylamino]-2,2-dimethyl-3-oxo-
|
| Molecular Formula |
C12H13BrFNO3
|
| Molecular Weight |
318.14
|
| Smiles |
CN(C(=O)C(C)(C)C(=O)O)c1cc(Br)ccc1F
|
CN(C(=O)C(C)(C)C(=O)O)c1cc(Br)ccc1F
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.