| Name |
(2R,2'R)-2,2'-(Ethane-1,2-diylbis(azanediyl))bis(3-mercaptopropanoic acid) dihydrochloride
|
| Molecular Formula |
C8H18Cl2N2O4S2
|
| Molecular Weight |
341.3
|
| Smiles |
Cl.Cl.O=C(O)C(CS)NCCNC(CS)C(=O)O
|
Cl.Cl.O=C(O)C(CS)NCCNC(CS)C(=O)O
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.