| Name |
3-(1H-1,3-benzodiazol-5-yl)-3,3-difluoropropan-1-ol
|
| Molecular Formula |
C10H10F2N2O
|
| Molecular Weight |
212.20
|
| Smiles |
OCCC(F)(F)c1ccc2nc[nH]c2c1
|
OCCC(F)(F)c1ccc2nc[nH]c2c1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.