| Name |
Fmoc-L-Met-L-Thr[PSI(Me,Me)Pro]-OH
|
| Molecular Formula |
C27H32N2O6S
|
| Molecular Weight |
512.6
|
| Smiles |
CSCCC(NC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)N1C(C(=O)O)C(C)OC1(C)C
|
CSCCC(NC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)N1C(C(=O)O)C(C)OC1(C)C
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.