| Name |
Methyl 6-bromo-2-(2,2,2-trifluoroacetyl)-1,2,3,4-tetrahydroisoquinoline-8-carboxylate
|
| Molecular Formula |
C13H11BrF3NO3
|
| Molecular Weight |
366.13
|
| Smiles |
COC(=O)c1cc(Br)cc2c1CN(C(=O)C(F)(F)F)CC2
|
COC(=O)c1cc(Br)cc2c1CN(C(=O)C(F)(F)F)CC2
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.