| Name |
5-chloro-N-(6-fluoro-1,3-dimethyl-2,2-dioxido-1,3-dihydrobenzo[c][1,2,5]thiadiazol-5-yl)thiophene-2-sulfonamide
|
| Molecular Formula |
C12H11ClFN3O4S3
|
| Molecular Weight |
411.9
|
| Smiles |
CN1c2cc(F)c(NS(=O)(=O)c3ccc(Cl)s3)cc2N(C)S1(=O)=O
|
CN1c2cc(F)c(NS(=O)(=O)c3ccc(Cl)s3)cc2N(C)S1(=O)=O
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.