| Name |
1-[[1-(23-Amino-3,6,9,12,15,18,21-heptaoxatricos-1-yl)-1H-1,2,3-triazol-4-yl]methyl]-1H-pyrrole-2,5-dione
|
| Molecular Formula |
C23H39N5O9
|
| Molecular Weight |
529.6
|
| Smiles |
NCCOCCOCCOCCOCCOCCOCCOCCn1cc(CN2C(=O)C=CC2=O)nn1
|
NCCOCCOCCOCCOCCOCCOCCOCCn1cc(CN2C(=O)C=CC2=O)nn1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.