| Name |
2-Chloro-5-{[3-fluoro-5-(trifluoromethyl)benzoyl]amino}benzoic acid
|
| Molecular Formula |
C15H8ClF4NO3
|
| Molecular Weight |
361.67
|
| Smiles |
O=C(Nc1ccc(Cl)c(C(=O)O)c1)c1cc(F)cc(C(F)(F)F)c1
|
O=C(Nc1ccc(Cl)c(C(=O)O)c1)c1cc(F)cc(C(F)(F)F)c1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.