| Name |
Diquinoxalino[2,3-a:2',3'-c]phenazine-2,3,8,9,14,15-hexacarboxylic acid
|
| Molecular Formula |
C30H12N6O12
|
| Molecular Weight |
648.4
|
| Smiles |
O=C(O)c1cc2nc3c4nc5cc(C(=O)O)c(C(=O)O)cc5nc4c4nc5cc(C(=O)O)c(C(=O)O)cc5nc4c3nc2cc1C(=O)O
|
O=C(O)c1cc2nc3c4nc5cc(C(=O)O)c(C(=O)O)cc5nc4c4nc5cc(C(=O)O)c(C(=O)O)cc5nc4c3nc2cc1C(=O)O
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.