| Name |
(R)-6'-Bromo-4'-hydroxyspiro[cyclobutane-1,2'-thiochromane] 1',1'-dioxide
|
| Molecular Formula |
C12H13BrO3S
|
| Molecular Weight |
317.20
|
| Smiles |
O=S1(=O)c2ccc(Br)cc2C(O)CC12CCC2
|
O=S1(=O)c2ccc(Br)cc2C(O)CC12CCC2
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.