| Name |
L-Idopyranose, 3-O-(phenylmethyl)-, 1,2,4,6-tetraacetate
|
| Molecular Formula |
C21H26O10
|
| Molecular Weight |
438.4
|
| Smiles |
CC(=O)OCC1OC(OC(C)=O)C(OC(C)=O)C(OCc2ccccc2)C1OC(C)=O
|
CC(=O)OCC1OC(OC(C)=O)C(OC(C)=O)C(OCc2ccccc2)C1OC(C)=O
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.