| Name |
1-Oxo-2-(2,6-dioxopiperidin-3-yl)-4,5,6,7-tetrafluoroisoindoline
|
| Molecular Formula |
C13H8F4N2O3
|
| Molecular Weight |
316.21
|
| Smiles |
O=C1CCC(N2Cc3c(F)c(F)c(F)c(F)c3C2=O)C(=O)N1
|
O=C1CCC(N2Cc3c(F)c(F)c(F)c(F)c3C2=O)C(=O)N1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.