| Name |
ethyl 3-[(4-methoxyphenyl)carbonyl]-1,1-dimethyl-1H,2H,3H,6H-azepino[4,5-b]indole-5-carboxylate
|
| Molecular Formula |
C25H26N2O4
|
| Molecular Weight |
418.5
|
| Smiles |
CCOC(=O)C1=CN(C(=O)c2ccc(OC)cc2)CC(C)(C)c2c1[nH]c1ccccc21
|
CCOC(=O)C1=CN(C(=O)c2ccc(OC)cc2)CC(C)(C)c2c1[nH]c1ccccc21
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.