| Name |
3,5-Diethyl 1,4-dihydro-2,6-dimethyl-4-(trichloromethyl)-3,5-pyridinedicarboxylate
|
| Molecular Formula |
C14H18Cl3NO4
|
| Molecular Weight |
370.7
|
| Smiles |
CCOC(=O)C1=C(C)NC(C)=C(C(=O)OCC)C1C(Cl)(Cl)Cl
|
CCOC(=O)C1=C(C)NC(C)=C(C(=O)OCC)C1C(Cl)(Cl)Cl
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.