| Name |
Carbamic acid, N-methyl-N-(3-methyl-1H-1,2,4-triazol-5-yl)-, 1,1-dimethylethyl ester
|
| Molecular Formula |
C9H16N4O2
|
| Molecular Weight |
212.25
|
| Smiles |
Cc1nc(N(C)C(=O)OC(C)(C)C)n[nH]1
|
Cc1nc(N(C)C(=O)OC(C)(C)C)n[nH]1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.