| Name |
5-(furan-2-yl)-2-(1H-1,2,3,4-tetrazol-1-yl)benzoic acid
|
| Molecular Formula |
C12H8N4O3
|
| Molecular Weight |
256.22
|
| Smiles |
O=C(O)c1cc(-c2ccco2)ccc1-n1cnnn1
|
O=C(O)c1cc(-c2ccco2)ccc1-n1cnnn1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.