| Name |
tert-Butyl 4-{[(3-{[1-(tert-butoxycarbonyl)-4-piperidinyl]methoxy}propanoyl)oxy]methyl}-1-piperidinecarboxylate
|
| Molecular Formula |
C25H44N2O7
|
| Molecular Weight |
484.6
|
| Smiles |
CC(C)(C)OC(=O)N1CCC(COCCC(=O)OCC2CCN(C(=O)OC(C)(C)C)CC2)CC1
|
CC(C)(C)OC(=O)N1CCC(COCCC(=O)OCC2CCN(C(=O)OC(C)(C)C)CC2)CC1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.