| Name |
3-(5-(Aminomethyl)-1,2,4-oxadiazol-3-yl)phenol hydrochloride
|
| Molecular Formula |
C9H10ClN3O2
|
| Molecular Weight |
227.65
|
| Smiles |
Cl.NCc1nc(-c2cccc(O)c2)no1
|
Cl.NCc1nc(-c2cccc(O)c2)no1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.