| Name |
2-({4-oxo-1-phenyl-1H,4H,5H-pyrazolo[3,4-d]pyrimidin-6-yl}amino)-2-phenylacetamide
|
| Molecular Formula |
C19H16N6O2
|
| Molecular Weight |
360.4
|
| Smiles |
NC(=O)C(Nc1nc2c(cnn2-c2ccccc2)c(=O)[nH]1)c1ccccc1
|
NC(=O)C(Nc1nc2c(cnn2-c2ccccc2)c(=O)[nH]1)c1ccccc1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.