| Name |
2H-1,2,4-Benzothiadiazine, 3-bromo-6,7-difluoro-5-methoxy-, 1,1-dioxide
|
| Molecular Formula |
C8H5BrF2N2O3S
|
| Molecular Weight |
327.10
|
| Smiles |
COc1c(F)c(F)cc2c1NC(Br)=NS2(=O)=O
|
COc1c(F)c(F)cc2c1NC(Br)=NS2(=O)=O
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.