| Name |
2-[(3,5-Dimethyl-1,2,4-triazol-1-yl)methyl]piperidine;dihydrochloride
|
| Molecular Formula |
C10H20Cl2N4
|
| Molecular Weight |
267.20
|
| Smiles |
Cc1nc(C)n(CC2CCCCN2)n1.Cl.Cl
|
Cc1nc(C)n(CC2CCCCN2)n1.Cl.Cl
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.